CAS 30937-70-3 appears in our catalog under these names: 2-Chloro-4-methyl-6-phenyl-1,3,5-triazine, 95%, 2-Chloro-4-methyl-6-phenyl-1,3,5-triazine, >97%, >97%, 2-CHLORO-4-METHYL-6-PHENYL-1,3,5-TRIAZINE. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
2-chloro-4-methyl-6-phenyl-1,3,5-triazine (CAS 30937-70-3) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 2-chloro-4-methyl-6-phenyl-1,3,5-triazine. InChIKey: MZHFNHGPRUIATC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 2-chloro-4-methyl-6-phenyl-1,3,5-triazine |
| InChIKey | MZHFNHGPRUIATC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)