Products 1192814-51-9
CAS 1192814-51-9 appears in our catalog under these names: 6-(4-Chlorophenyl)pyrimidin-4-amine, 95%, 6-(4-Chlorophenyl)pyrimidin-4-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-(4-chlorophenyl)pyrimidin-4-amine (CAS 1192814-51-9) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 6-(4-chlorophenyl)pyrimidin-4-amine. InChIKey: HTWQXUINJKVXIO-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 6-(4-chlorophenyl)pyrimidin-4-amine |
| InChIKey | HTWQXUINJKVXIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=N2)N)Cl |
Computed by PubChem (NCBI)