CAS 35202-25-6 is the registry number for 5-(4-Chlorophenyl)pyrimidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-(4-chlorophenyl)pyrimidin-4-amine (CAS 35202-25-6) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 5-(4-chlorophenyl)pyrimidin-4-amine. InChIKey: KGDRSRGXGBIWDQ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 5-(4-chlorophenyl)pyrimidin-4-amine |
| InChIKey | KGDRSRGXGBIWDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CN=C2N)Cl |
Computed by PubChem (NCBI)