CAS 5418-94-0 appears in our catalog under these names: 2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one, 96%, 2-Chloro-4h-pyrido(1,2-a)pyrimidin-4-one, 2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one, 98%, 98%, 2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 500mg, 2.5g.
2-chloropyrido[1,2-a]pyrimidin-4-one (CAS 5418-94-0) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 2-chloropyrido[1,2-a]pyrimidin-4-one. InChIKey: CGGMQFDVKUHJED-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 2-chloropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | CGGMQFDVKUHJED-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1)Cl |
Computed by PubChem (NCBI)