Products 286411-19-6
CAS 286411-19-6 is the registry number for 7-Chloro-1,8-naphthyridin-4(1h)-one, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg.
7-chloro-1H-1,8-naphthyridin-4-one (CAS 286411-19-6) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 7-chloro-1H-1,8-naphthyridin-4-one. InChIKey: QSABLAUDROJKSH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 7-chloro-1H-1,8-naphthyridin-4-one |
| InChIKey | QSABLAUDROJKSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=O)C=CN2)Cl |
Computed by PubChem (NCBI)