CAS 286411-19-6 appears in our catalog under these names: 7-Chloro-1,8-naphthyridin-4(1h)-one, 95%, 7-Chloro-1,8-naphthyridin-4(1H)-one, 95%, 95%, 7-Chloro-1,8-naphthyridin-4(1H)-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg.
7-chloro-1H-1,8-naphthyridin-4-one (CAS 286411-19-6) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 7-chloro-1H-1,8-naphthyridin-4-one. InChIKey: QSABLAUDROJKSH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 7-chloro-1H-1,8-naphthyridin-4-one |
| InChIKey | QSABLAUDROJKSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=O)C=CN2)Cl |
Computed by PubChem (NCBI)