CAS 1198413-03-4 is the registry number for 9-Chloro-pyrido[1,2-a]pyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
9-chloropyrido[1,2-a]pyrimidin-4-one (CAS 1198413-03-4) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 9-chloropyrido[1,2-a]pyrimidin-4-one. InChIKey: OUKLJVNKIIWBEJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 9-chloropyrido[1,2-a]pyrimidin-4-one |
| InChIKey | OUKLJVNKIIWBEJ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=O)C=CN=C2C(=C1)Cl |
Computed by PubChem (NCBI)