Products 827-44-1
CAS 827-44-1 appears in our catalog under these names: 5-Chloro-3-phenyl-1,2,4-oxadiazole, 95%, 5-Chloro-3-phenyl-1,2,4-oxadiazole, 98+%, 5–Chloro–3–phenyl–1，2，4–oxadiazole, 5-Chloro-3-phenyl-1,2,4-oxadiazole, 5-Chloro-3-phenyl-1,2,4-oxadiazole, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 500mg, 100mg.
5-chloro-3-phenyl-1,2,4-oxadiazole (CAS 827-44-1) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-3-phenyl-1,2,4-oxadiazole. InChIKey: MOJYPXFSJLVCRN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1,2,4-oxadiazole |
| InChIKey | MOJYPXFSJLVCRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)Cl |
Computed by PubChem (NCBI)