CAS 1483-31-4 appears in our catalog under these names: 2-Chloro-5-phenyl-1,3,4-oxadiazole, 96%, 2-Chloro-5-phenyl-1,3,4-oxadiazole, 98%, 2-Chloro-5-phenyl-1,3,4-oxadiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 50mg.
2-chloro-5-phenyl-1,3,4-oxadiazole (CAS 1483-31-4) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 2-chloro-5-phenyl-1,3,4-oxadiazole. InChIKey: QSGNNXKJPIMRPO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 2-chloro-5-phenyl-1,3,4-oxadiazole |
| InChIKey | QSGNNXKJPIMRPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)Cl |
Computed by PubChem (NCBI)