cas: 71648-45-8 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)acetophenone, 97% (CAS 71648-45-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005704-1G |
| cas | 71648-45-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 435.28 Pln | |
| Fluorochem | 100g | 1570.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-[2-chloro-5-(trifluoromethyl)phenyl]ethanone (CAS 71648-45-8) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 1-[2-chloro-5-(trifluoromethyl)phenyl]ethanone. InChIKey: YRGBMTWHOFQSDJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 1-[2-chloro-5-(trifluoromethyl)phenyl]ethanone |
| InChIKey | YRGBMTWHOFQSDJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)