CAS 913835-75-3 appears in our catalog under these names: 3-Borono-4-chlorobenzoic acid, 98%, 98%, 5–Carboxy–2–chlorobenzeneboronic acid, 5-Carboxy-2-chlorophenylboronic Acid (contains varying amounts of Anhydride), 5-Carboxy-2-chlorophenylboronic acid, 95%. Offered by: Chemat, GLPBio, TCI, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g.
3-borono-4-chlorobenzoic acid (CAS 913835-75-3) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 3-borono-4-chlorobenzoic acid. InChIKey: ZITWKFSVFMUWIE-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 3-borono-4-chlorobenzoic acid |
| InChIKey | ZITWKFSVFMUWIE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)O)Cl)(O)O |
Computed by PubChem (NCBI)