cas: 333408-44-9 — see every product listed under this CAS number, including other names
2-Chloro-6,7-dimethylquinoline-3-methanol, 95%, 95% (CAS 333408-44-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CL0G-250mg |
| cas | 333408-44-9 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 3026.00 Pln | |
| Chemat | 100mg | 1845.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2-chloro-6,7-dimethylquinolin-3-yl)methanol (CAS 333408-44-9) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: (2-chloro-6,7-dimethylquinolin-3-yl)methanol. InChIKey: FVHRDDVYXFKXKE-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (2-chloro-6,7-dimethylquinolin-3-yl)methanol |
| InChIKey | FVHRDDVYXFKXKE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(N=C2C=C1C)Cl)CO |
Computed by PubChem (NCBI)