CAS 1134334-67-0 is the registry number for 2-Chloro-1-(2,7-dimethyl-1h-indol-3-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-1-(2,7-dimethyl-1H-indol-3-yl)ethanone (CAS 1134334-67-0) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: 2-chloro-1-(2,7-dimethyl-1H-indol-3-yl)ethanone. InChIKey: NNYPMPAZLWMVJR-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 2-chloro-1-(2,7-dimethyl-1H-indol-3-yl)ethanone |
| InChIKey | NNYPMPAZLWMVJR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(N2)C)C(=O)CCl |
Computed by PubChem (NCBI)