Products 946692-39-3
CAS 946692-39-3 is the registry number for 2-(Chloromethyl)-6,8-dimethyl-4(1h)-quinolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(chloromethyl)-6,8-dimethyl-1H-quinolin-4-one (CAS 946692-39-3) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: 2-(chloromethyl)-6,8-dimethyl-1H-quinolin-4-one. InChIKey: LSQASVXCCQEYHR-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 2-(chloromethyl)-6,8-dimethyl-1H-quinolin-4-one |
| InChIKey | LSQASVXCCQEYHR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C=C(N2)CCl)C |
Computed by PubChem (NCBI)