Products 1704074-36-1
CAS 1704074-36-1 is the registry number for (4–Chloro–3–(pyrrolidin–1–ylmethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-chloro-3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid (CAS 1704074-36-1) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: [4-chloro-3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid. InChIKey: AITNJDZXQDNUFQ-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | [4-chloro-3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | AITNJDZXQDNUFQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)CN2CCCC2)(O)O |
Computed by PubChem (NCBI)