CAS 2225171-84-4 is the registry number for 4–(Piperidin–4–yl)–3–chlorophenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(3-chloro-4-piperidin-4-ylphenyl)boronic acid (CAS 2225171-84-4) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: (3-chloro-4-piperidin-4-ylphenyl)boronic acid. InChIKey: PJVKCCNOURZVCN-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | (3-chloro-4-piperidin-4-ylphenyl)boronic acid |
| InChIKey | PJVKCCNOURZVCN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2CCNCC2)Cl)(O)O |
Computed by PubChem (NCBI)