CAS 2225174-25-2 appears in our catalog under these names: 2–Chloro–4–(piperidin–1–yl)phenylboronic acid, 2-Chloro-4-(piperidin-1-yl)phenylboronic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 25mg, 1g.
(2-chloro-4-piperidin-1-ylphenyl)boronic acid (CAS 2225174-25-2) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: (2-chloro-4-piperidin-1-ylphenyl)boronic acid. InChIKey: XXIRGXAUAUCOBO-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | (2-chloro-4-piperidin-1-ylphenyl)boronic acid |
| InChIKey | XXIRGXAUAUCOBO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCCCC2)Cl)(O)O |
Computed by PubChem (NCBI)