cas: 64460-50-0 — see every product listed under this CAS number, including other names
2-Chloro-6-(methylamino)benzoic acid, 97% (CAS 64460-50-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A614588-10g |
| cas | 64460-50-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17588.41 Pln | |
| AmBeed | 5g | 10479.49 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-6-(methylamino)benzoic acid (CAS 64460-50-0) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-6-(methylamino)benzoic acid. InChIKey: GTDOXYQDGNOMOM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-chloro-6-(methylamino)benzoic acid |
| InChIKey | GTDOXYQDGNOMOM-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)