cas: 67886-68-4 — see every product listed under this CAS number, including other names
2-Chloro-6-methoxynaphthalene, 97%, 97% (CAS 67886-68-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FEGH-250mg |
| cas | 67886-68-4 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1504.40 Pln | |
| Chemat | 5g | 5104.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-methoxynaphthalene (CAS 67886-68-4) is a chemical compound with the molecular formula C11H9ClO and a molecular weight of 192.64 g/mol. IUPAC name: 2-chloro-6-methoxynaphthalene. InChIKey: DFJBXCAVJOGNDS-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 2-chloro-6-methoxynaphthalene |
| InChIKey | DFJBXCAVJOGNDS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)