cas: 80126-50-7 — see every product listed under this CAS number, including other names
2-Chloro-D-phenylalanine, 98% (CAS 80126-50-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F225397-1G |
| cas | 80126-50-7 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 299.91 Pln | |
| Fluorochem | 25g | 575.86 Pln | |
| Fluorochem | 100g | 2090.95 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 266.00 Pln | |
| Chemat | 25g | 506.00 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-2-amino-3-(2-chlorophenyl)propanoic acid (CAS 80126-50-7) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (2R)-2-amino-3-(2-chlorophenyl)propanoic acid. InChIKey: CVZZNRXMDCOHBG-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-chlorophenyl)propanoic acid |
| InChIKey | CVZZNRXMDCOHBG-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)