2-Chloroquinoline-6-sulfonyl chloride, 98%
cas: 205055-71-6 — see every product listed under this CAS number, including other names
2-Chloroquinoline-6-sulfonyl chloride, 98% (CAS 205055-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A838438-100mg |
| cas | 205055-71-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1321.56 Pln | |
| Ambeed | 5g | 4186.25 Pln | |
| Ambeed | 10g | 7067.62 Pln | |
| BLDpharm | 100mg | 358.79 Pln | |
| BLDpharm | 250mg | 586.48 Pln | |
| BLDpharm | 1g | 1413.97 Pln | |
| BLDpharm | 5g | 4507.33 Pln | |
| BLDpharm | 10g | 7611.79 Pln | |
| Fluorochem | 100mg | 601.89 Pln | |
| Fluorochem | 250mg | 1008.00 Pln | |
| Fluorochem | 1g | 2450.20 Pln | |
| Fluorochem | 5g | 7651.49 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-chloroquinoline-6-sulfonyl chloride (CAS 205055-71-6) is a chemical compound with the molecular formula C9H5Cl2NO2S and a molecular weight of 262.11 g/mol. IUPAC name: 2-chloroquinoline-6-sulfonyl chloride. InChIKey: OBSXSFGTHBBROC-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2S |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 2-chloroquinoline-6-sulfonyl chloride |
| InChIKey | OBSXSFGTHBBROC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)Cl)C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)