CAS 205055-64-7 appears in our catalog under these names: 1-Chloroisoquinoline-6-sulfonyl chloride, 95%, 1-Chloro-6-isoquinolinesulfonyl chloride, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-chloroisoquinoline-6-sulfonyl chloride (CAS 205055-64-7) is a chemical compound with the molecular formula C9H5Cl2NO2S and a molecular weight of 262.11 g/mol. IUPAC name: 1-chloroisoquinoline-6-sulfonyl chloride. InChIKey: LAIUOZPNGHEZEQ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2S |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 1-chloroisoquinoline-6-sulfonyl chloride |
| InChIKey | LAIUOZPNGHEZEQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)