Products 1956366-76-9
CAS 1956366-76-9 appears in our catalog under these names: 3-Chloroquinoline-5-sulfonyl chloride, 95%, 3-Chloroquinoline-5-sulfonyl chloride, 97%, 97%, 3-CHLOROQUINOLINE-5-SULFONYL CHLORIDE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
3-chloroquinoline-5-sulfonyl chloride (CAS 1956366-76-9) is a chemical compound with the molecular formula C9H5Cl2NO2S and a molecular weight of 262.11 g/mol. IUPAC name: 3-chloroquinoline-5-sulfonyl chloride. InChIKey: JJAMZNOYZWZISA-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2S |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 3-chloroquinoline-5-sulfonyl chloride |
| InChIKey | JJAMZNOYZWZISA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Cl)C(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)