Products 2414358-16-8
CAS 2414358-16-8 is the registry number for Methyl 5,7-dichlorothieno[3,2-b]pyridine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5,7-dichlorothieno[3,2-b]pyridine-3-carboxylate (CAS 2414358-16-8) is a chemical compound with the molecular formula C9H5Cl2NO2S and a molecular weight of 262.11 g/mol. IUPAC name: methyl 5,7-dichlorothieno[3,2-b]pyridine-3-carboxylate. InChIKey: LZGXNJVJHWEJJE-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2S |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | methyl 5,7-dichlorothieno[3,2-b]pyridine-3-carboxylate |
| InChIKey | LZGXNJVJHWEJJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC2=C1N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)