Products 930396-13-7

CAS 930396-13-7 is the registry number for 8-Chloroquinoline-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

8-chloroquinoline-5-sulfonyl chloride (CAS 930396-13-7) is a chemical compound with the molecular formula C9H5Cl2NO2S and a molecular weight of 262.11 g/mol. IUPAC name: 8-chloroquinoline-5-sulfonyl chloride. InChIKey: VHALSBXKHKIRCH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5Cl2NO2S
Molecular weight262.11 g/mol
IUPAC name8-chloroquinoline-5-sulfonyl chloride
InChIKeyVHALSBXKHKIRCH-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2N=C1)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)