cas: 1448-87-9 — see every product listed under this CAS number, including other names
2-Chloroquinoxaline 98% (CAS 1448-87-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160115-250mg |
| cas | 1448-87-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 192.38 Pln | |
| Ambeed | 100g | 548.38 Pln | |
| Ambeed | 500g | 2445.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A160115 |
2-chloroquinoxaline (CAS 1448-87-9) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 2-chloroquinoxaline. InChIKey: BYHVGQHIAFURIL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 2-chloroquinoxaline |
| InChIKey | BYHVGQHIAFURIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)Cl |
Computed by PubChem (NCBI)