CAS 1448-87-9 appears in our catalog under these names: 2-Chloroquinoxaline, 2–chloroquinoxaline, 2-Chloroquinoxaline, >98.0%(GC), 2-Chloroquinoxaline, 97%, 2-Chloroquinoxaline 98%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 10g, 100g, 25g, 1g, 5g, 250mg, 500g.
2-chloroquinoxaline (CAS 1448-87-9) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 2-chloroquinoxaline. InChIKey: BYHVGQHIAFURIL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 2-chloroquinoxaline |
| InChIKey | BYHVGQHIAFURIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)Cl |
Computed by PubChem (NCBI)