CAS 69360-26-5 appears in our catalog under these names: 2–Cyanobenzenesulfonyl chloride, 2-Cyanobenzenesulfonyl chloride, 97% , 2-Cyanobenzenesulfonyl Chloride, >97.0%(GC), 2-Cyanobenzenesulfonyl chloride, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
2-cyanobenzenesulfonyl chloride (CAS 69360-26-5) is a chemical compound with the molecular formula C7H4ClNO2S and a molecular weight of 201.63 g/mol. IUPAC name: 2-cyanobenzenesulfonyl chloride. InChIKey: NQAYCMBZPAARNO-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 2-cyanobenzenesulfonyl chloride |
| InChIKey | NQAYCMBZPAARNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)