CAS 332099-03-3 appears in our catalog under these names: 2-Chloro-6H-thieno(2,3-b)pyrrole-5-carboxylic acid, 95%, 2-Chloro-6H-thieno(2,3-b)pyrrole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (CAS 332099-03-3) is a chemical compound with the molecular formula C7H4ClNO2S and a molecular weight of 201.63 g/mol. IUPAC name: 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylic acid. InChIKey: SOGNHUJSAKAIRG-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylic acid |
| InChIKey | SOGNHUJSAKAIRG-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1C=C(S2)Cl)C(=O)O |
Computed by PubChem (NCBI)