CAS 332099-33-9 appears in our catalog under these names: 3-Chloro-4H-thieno(3,2-b)pyrrole-5-carboxylic acid, 97%, 3-Chloro-4H-thieno(3,2-b)pyrrole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 332099-33-9) is a chemical compound with the molecular formula C7H4ClNO2S and a molecular weight of 201.63 g/mol. IUPAC name: 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: FDGNVONVURZBLL-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | FDGNVONVURZBLL-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1SC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)