CAS 567-19-1 appears in our catalog under these names: 3-Chloro-1lambda6,2-benzothiazole-1,1-dione, 3–Chlorobenzoisothiazole 1,1–Dioxide, 3-Chlorobenzoisothiazole 1,1-Dioxide 98%, 3-chloro-1,2-benzisothiazole 1,1-dioxide, 95%. Offered by: TRC, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 2.5g, 10g.
3-chloro-1,2-benzothiazole 1,1-dioxide (CAS 567-19-1) is a chemical compound with the molecular formula C7H4ClNO2S and a molecular weight of 201.63 g/mol. IUPAC name: 3-chloro-1,2-benzothiazole 1,1-dioxide. InChIKey: VBEJRJPHNPIURV-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 3-chloro-1,2-benzothiazole 1,1-dioxide |
| InChIKey | VBEJRJPHNPIURV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)Cl |
Computed by PubChem (NCBI)