CAS 332099-40-8 appears in our catalog under these names: 2-Chloro-4h-thieno[3,2-b]pyrrole-5-carboxylic acid, 95%, 2-Chloro-4H-thieno(3,2-b)pyrrole-5-carboxylic acid, 97%, 2–Chloro–4H–thieno(3,2–b)pyrrole–5–carboxylic acid, 2-Chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid, 97%, 97%, 2-Chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 10g, 5g, 250mg.
2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 332099-40-8) is a chemical compound with the molecular formula C7H4ClNO2S and a molecular weight of 201.63 g/mol. IUPAC name: 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: OWJRYNILRVVVFK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | OWJRYNILRVVVFK-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1SC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)