cas: 1122089-67-1 — see every product listed under this CAS number, including other names
2-Cyclopentyl-6-methoxyisonicotinic acid, 97% (CAS 1122089-67-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A799678-1g |
| cas | 1122089-67-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 14229.25 Pln | |
| Fluorochem | 100mg | 3767.44 Pln | |
| Fluorochem | 250mg | 5980.20 Pln | |
| Fluorochem | 500mg | 9921.52 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-cyclopentyl-6-methoxypyridine-4-carboxylic acid (CAS 1122089-67-1) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 2-cyclopentyl-6-methoxypyridine-4-carboxylic acid. InChIKey: HNBBOUJRDHVLFJ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-cyclopentyl-6-methoxypyridine-4-carboxylic acid |
| InChIKey | HNBBOUJRDHVLFJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=N1)C2CCCC2)C(=O)O |
Computed by PubChem (NCBI)