cas: 19523-57-0 — see every product listed under this CAS number, including other names
2-Ethoxy-1-naphthaldehyde, 98%, 98% (CAS 19523-57-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H6Q-250mg |
| cas | 19523-57-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 10g | 731.60 Pln | |
| Chemat | 25g | 1509.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-ethoxynaphthalene-1-carbaldehyde (CAS 19523-57-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-ethoxynaphthalene-1-carbaldehyde. InChIKey: IMNKQTWVJHODOS-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-ethoxynaphthalene-1-carbaldehyde |
| InChIKey | IMNKQTWVJHODOS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C2=CC=CC=C2C=C1)C=O |
Computed by PubChem (NCBI)