2-Ethyl 5-methyl 1H-indole-2,5-dicarboxylate, 95%
cas: 884494-66-0 — see every product listed under this CAS number, including other names
2-Ethyl 5-methyl 1H-indole-2,5-dicarboxylate, 95% (CAS 884494-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A530183-100mg |
| cas | 884494-66-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1204.75 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 425.43 Pln | |
| BLDpharm | 5g | 1291.79 Pln | |
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 351.98 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate (CAS 884494-66-0) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate. InChIKey: DFILAPAOMFUIAA-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate |
| InChIKey | DFILAPAOMFUIAA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
2-Ethyl 5-methyl 1H-indole-2,5-dicarboxylate, Indole-2,5-dicarboxylic acid 2-ethyl ester 5-methyl ester, Indole-2,5-dicarboxylic acid-2-ethyl ester-5-methyl ester, 2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate, 2-Ethyl5-methyl1H-indole-2,5-dicarboxylate, O2-ethyl O5-methyl 1H-indole-2,5-dicarboxylate