Products 884494-66-0
CAS 884494-66-0 is the registry number for 2-Ethyl 5-methyl 1H-indole-2,5-dicarboxylate, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate (CAS 884494-66-0) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate. InChIKey: DFILAPAOMFUIAA-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate |
| InChIKey | DFILAPAOMFUIAA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
2-Ethyl 5-methyl 1H-indole-2,5-dicarboxylate, Indole-2,5-dicarboxylic acid 2-ethyl ester 5-methyl ester, Indole-2,5-dicarboxylic acid-2-ethyl ester-5-methyl ester, 2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate, 2-Ethyl5-methyl1H-indole-2,5-dicarboxylate, O2-ethyl O5-methyl 1H-indole-2,5-dicarboxylate