cas: 711601-13-7 — see every product listed under this CAS number, including other names
2-Ethyl-7-nitro-1,2,3,4-tetrahydroisoquinoline 97% (CAS 711601-13-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A976626-100mg |
| cas | 711601-13-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A976626 |
2-ethyl-7-nitro-3,4-dihydro-1H-isoquinoline (CAS 711601-13-7) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 2-ethyl-7-nitro-3,4-dihydro-1H-isoquinoline. InChIKey: WYGYMIKICPQWCH-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-ethyl-7-nitro-3,4-dihydro-1H-isoquinoline |
| InChIKey | WYGYMIKICPQWCH-UHFFFAOYSA-N |
| SMILES | CCN1CCC2=C(C1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)