cas: 209982-56-9 — see every product listed under this CAS number, including other names
2-Ethyladamantan-2-yl methacrylate 97% (stabilized with MEHQ) (CAS 209982-56-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A258809-1g |
| cas | 209982-56-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 843.19 Pln | |
| Ambeed | 25g | 2806.75 Pln | |
| Ambeed | 100g | 9793.25 Pln |
| purity | 97% (stabilized with MEHQ) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A258809 |
(2-ethyl-2-adamantyl) 2-methylprop-2-enoate (CAS 209982-56-9) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: (2-ethyl-2-adamantyl) 2-methylprop-2-enoate. InChIKey: DCTVCFJTKSQXED-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | (2-ethyl-2-adamantyl) 2-methylprop-2-enoate |
| InChIKey | DCTVCFJTKSQXED-UHFFFAOYSA-N |
| SMILES | CCC1(C2CC3CC(C2)CC1C3)OC(=O)C(=C)C |
Computed by PubChem (NCBI)