cas: 209982-56-9 — see every product listed under this CAS number, including other names
2-Ethyladamantan-2-yl methacrylate, 98%, 98% (CAS 209982-56-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113KHH-100mg |
| cas | 209982-56-9 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 602.00 Pln | |
| Chemat | 25g | 1802.00 Pln | |
| Chemat | 100g | 5637.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-ethyl-2-adamantyl) 2-methylprop-2-enoate (CAS 209982-56-9) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: (2-ethyl-2-adamantyl) 2-methylprop-2-enoate. InChIKey: DCTVCFJTKSQXED-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | (2-ethyl-2-adamantyl) 2-methylprop-2-enoate |
| InChIKey | DCTVCFJTKSQXED-UHFFFAOYSA-N |
| SMILES | CCC1(C2CC3CC(C2)CC1C3)OC(=O)C(=C)C |
Computed by PubChem (NCBI)