CAS 437-86-5 appears in our catalog under these names: 2–Fluoro–3–nitrotoluene, 2-Fluoro-3-nitrotoluene, 98% , 2-Fluoro-3-nitrotoluene, 2-Fluoro-3-nitrotoluene, >98.0%(GC), 2-Fluoro-1-methyl-3-nitrobenzene 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 500g, 50g, 5g, 250g, 1000g, 10g.
2-fluoro-1-methyl-3-nitrobenzene (CAS 437-86-5) is a chemical compound with the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. IUPAC name: 2-fluoro-1-methyl-3-nitrobenzene. InChIKey: NBCNUIXYBLFJMI-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO2 |
|---|---|
| Molecular weight | 155.13 g/mol |
| IUPAC name | 2-fluoro-1-methyl-3-nitrobenzene |
| InChIKey | NBCNUIXYBLFJMI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)