CAS 61794-59-0 appears in our catalog under these names: 4-Ethynyl-2,3,5,6-tetrafluoroaniline, 95%, 4-Ethynyl-2,3,5,6-tetrafluoroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-ethynyl-2,3,5,6-tetrafluoroaniline (CAS 61794-59-0) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 4-ethynyl-2,3,5,6-tetrafluoroaniline. InChIKey: QJIDXHJAWUUICJ-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 4-ethynyl-2,3,5,6-tetrafluoroaniline |
| InChIKey | QJIDXHJAWUUICJ-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C(=C(C(=C1F)F)N)F)F |
Computed by PubChem (NCBI)