CAS 1672663-80-7 appears in our catalog under these names: 2-(Difluoromethyl)-3,6-difluorobenzonitrile, 97%, 2-(Difluoromethyl)-3,6-difluorobenzonitrile, 97%, 97%, 2-(Difluoromethyl)-3,6-difluorobenzonitrile, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 500mg, 100mg, 250mg, 1g.
2-(difluoromethyl)-3,6-difluorobenzonitrile (CAS 1672663-80-7) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 2-(difluoromethyl)-3,6-difluorobenzonitrile. InChIKey: XDLFMPUGGRJQDY-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 2-(difluoromethyl)-3,6-difluorobenzonitrile |
| InChIKey | XDLFMPUGGRJQDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C#N)C(F)F)F |
Computed by PubChem (NCBI)