CAS 261951-81-9 appears in our catalog under these names: 3–Fluoro–2–trifluoromethylbenzonitrile, 3-Fluoro-2-(trifluoromethyl)benzonitrile 98%, 3-Fluoro-2-(trifluoromethyl)benzonitrile, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
3-fluoro-2-(trifluoromethyl)benzonitrile (CAS 261951-81-9) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)benzonitrile. InChIKey: ZLFIVXFFYDWCNG-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)benzonitrile |
| InChIKey | ZLFIVXFFYDWCNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)C#N |
Computed by PubChem (NCBI)