2-Fluoro-3-(trifluoromethyl)phenylboronic acid, 97%
cas: 157834-21-4 — see every product listed under this CAS number, including other names
2-Fluoro-3-(trifluoromethyl)phenylboronic acid, 97% (CAS 157834-21-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A112072-1g |
| cas | 157834-21-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 1021.19 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 100g | 818.00 Pln | |
| Chemat | 250g | 1782.80 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 353.23 Pln | |
| BLDpharm | 100g | 1097.42 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 157834-21-4) is a chemical compound with the molecular formula C7H5BF4O2 and a molecular weight of 207.92 g/mol. IUPAC name: [2-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: PKARAEQMGHJHMY-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O2 |
|---|---|
| Molecular weight | 207.92 g/mol |
| IUPAC name | [2-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PKARAEQMGHJHMY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-3-(trifluoromethyl)benzeneboronic acid, 2-Fluoro-3-(trifluoromethyl)phenylboronic acid, [2-fluoro-3-(trifluoromethyl)phenyl]boronic acid, (2-fluoro-3-(trifluoromethyl)phenyl)boronic acid, Boronic acid, B-[2-fluoro-3-(trifluoromethyl)phenyl]-, Boronic acid, [2-fluoro-3-(trifluoromethyl)phenyl]-, 2-Fluoro-3-trifluoromethylbenzeneboronic acid, 2-fluoro-3-trifluoromethyl-phenyl-boronic acid, 2-Fluoro-3-(trifluoromethyl)phenylboronic acid, 95%