CAS 1418595-79-5 appears in our catalog under these names: (4–(Difluoromethyl)–3,5–difluorophenyl)boronic acid, (4-(Difluoromethyl)-3,5-difluorophenyl)boronic acid, 97%, 97%, (4-(Difluoromethyl)-3,5-difluorophenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg.
[4-(difluoromethyl)-3,5-difluorophenyl]boronic acid (CAS 1418595-79-5) is a chemical compound with the molecular formula C7H5BF4O2 and a molecular weight of 207.92 g/mol. IUPAC name: [4-(difluoromethyl)-3,5-difluorophenyl]boronic acid. InChIKey: TZFBVIVPHAPUPS-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O2 |
|---|---|
| Molecular weight | 207.92 g/mol |
| IUPAC name | [4-(difluoromethyl)-3,5-difluorophenyl]boronic acid |
| InChIKey | TZFBVIVPHAPUPS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C(F)F)F)(O)O |
Computed by PubChem (NCBI)