Products 864759-68-2
CAS 864759-68-2 appears in our catalog under these names: (3-Fluoro-4-(trifluoromethyl)phenyl)boronic acid, 98%, 98%, 3-Fluoro-4-trifluoromethylphenyl boronic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g, 100g.
[3-fluoro-4-(trifluoromethyl)phenyl]boronic acid (CAS 864759-68-2) is a chemical compound with the molecular formula C7H5BF4O2 and a molecular weight of 207.92 g/mol. IUPAC name: [3-fluoro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: OPDBJTGUPJBGII-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O2 |
|---|---|
| Molecular weight | 207.92 g/mol |
| IUPAC name | [3-fluoro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | OPDBJTGUPJBGII-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Fluoro-4-trifluoromethyl-phenylboronic acid, (3-Fluoro-4-(trifluoromethyl)phenyl)boronic acid, 3-fluoro-4-(trifluoromethyl)phenylboronic acid, [3-fluoro-4-(trifluoromethyl)phenyl]boronic acid, 3-Fluoro-4-trifluoromethylphenylboronic acid, 3-Fluoro-4-trifluoromethylphenyl boronic acid, (3-Fluoro-4-(trifluoromethyl)phenyl)boronicacid, 3-fluoro-4-(trifluoromethyl)-phenyl boronic acid