CAS 182344-16-7 appears in our catalog under these names: 4-Fluoro-2-(trifluoromethyl)phenylboronic acid, 97%, 4-Fluoro-2-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), (4-Fluoro-2-(trifluoromethyl)phenyl)boronic acid, 98%, 98%, 4-Fluoro-2-(trifluoromethyl)benzeneboronic acid, 96%. Offered by: Thermo Scientific (Acros), TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
[4-fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS 182344-16-7) is a chemical compound with the molecular formula C7H5BF4O2 and a molecular weight of 207.92 g/mol. IUPAC name: [4-fluoro-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: SWUPLEAGZOKLNX-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O2 |
|---|---|
| Molecular weight | 207.92 g/mol |
| IUPAC name | [4-fluoro-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SWUPLEAGZOKLNX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)