cas: 1178280-85-7 — see every product listed under this CAS number, including other names
2-Fluoro-4-(1-methyl-1H-pyrazol-4-yl)benzoic acid, 97%, 97% (CAS 1178280-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL4C-100mg |
| cas | 1178280-85-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 500mg | 894.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-(1-methylpyrazol-4-yl)benzoic acid (CAS 1178280-85-7) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 2-fluoro-4-(1-methylpyrazol-4-yl)benzoic acid. InChIKey: OYVMRLAXKSOIEV-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2 |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 2-fluoro-4-(1-methylpyrazol-4-yl)benzoic acid |
| InChIKey | OYVMRLAXKSOIEV-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)