Products 288251-65-0

CAS 288251-65-0 is the registry number for 1-(4-Fluorophenyl)-3-methyl-1H-pyrazole-5-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 288251-65-0) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 2-(4-fluorophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: GKPPJKYOHIYGGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9FN2O2
Molecular weight220.20 g/mol
IUPAC name2-(4-fluorophenyl)-5-methylpyrazole-3-carboxylic acid
InChIKeyGKPPJKYOHIYGGZ-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1)C(=O)O)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)