Products 756752-22-4

CAS 756752-22-4 is the registry number for 1-(3-Fluorophenyl)-3-methyl-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(3-fluorophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 756752-22-4) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 2-(3-fluorophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: QQRGKMYCQHDEGV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9FN2O2
Molecular weight220.20 g/mol
IUPAC name2-(3-fluorophenyl)-5-methylpyrazole-3-carboxylic acid
InChIKeyQQRGKMYCQHDEGV-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1)C(=O)O)C2=CC(=CC=C2)F

Computed by PubChem (NCBI)