CAS 1342382-45-9 appears in our catalog under these names: 2-Fluoro-5-(1-methyl-1h-pyrazol-5-yl)benzoic acid, 95%, 2-Fluoro-5-(1-methyl-1h-pyrazol-5-yl)benzoic acid, ≥95%, ≥95%, 2-Fluoro-5-(1-methyl-1h-pyrazol-5-yl)benzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-fluoro-5-(2-methylpyrazol-3-yl)benzoic acid (CAS 1342382-45-9) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 2-fluoro-5-(2-methylpyrazol-3-yl)benzoic acid. InChIKey: YPWUXEVQWHKMPR-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2 |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 2-fluoro-5-(2-methylpyrazol-3-yl)benzoic acid |
| InChIKey | YPWUXEVQWHKMPR-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=CC(=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)